| Name | Cerium(III)oxalate hydrate |
| Synonyms | CERIUM(III) OXALATE Ceriumoxalate hydrate Cerium(III)oxalate hydrate CERIUM(III) OXALATE HYDRATE cerium(iii) oxalate, reacton Cerium iii oxalate, nonahydrate cerium(iii) oxalate hydrate, reacton ethanedioate, cerium(3+) salt, monohydrate |
| CAS | 15750-47-7 |
| EINECS | 629-618-4 |
| InChI | InChI=1/C2H2O4.Ce.H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;1H2/q;+3;/p-2 |
| Molecular Formula | C6H2Ce2O13 |
| Molar Mass | 562.3 |
| Melting Point | Degree of hydration, ~9 |
| Boling Point | 365.1℃ at 760mmHg |
| Water Solubility | Insoluble in water. Soluble in hot dilute HCl and H{2}SO{4} |
| Appearance | Powder |
| Merck | 14,2001 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Hygroscopic |
| MDL | MFCD00150139 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 21/22 - Harmful in contact with skin and if swallowed. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN3288 |
| WGK Germany | 1 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| Use | Used as a chemical reagent to make other cerium salts. It has the effects of invigorating the stomach, antiemetic and sedative, but it is a dramatic medicine. |